C17H19NO7 — CID 162820408
[3,4-dihydroxy-2-(methylamino)phenyl]-(2-hydroxy-3,4,5-trimethoxyphenyl)methanone (PubChem CID 162820408) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is [3,4-dihydroxy-2-(methylamino)phenyl]-(2-hydroxy-3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [3,4-dihydroxy-2-(methylamino)phenyl]-(2-hydroxy-3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 162820408 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [3,4-dihydroxy-2-(methylamino)phenyl]-(2-hydroxy-3,4,5-trimethoxyphenyl)methanone |
| SMILES | CNc1c(C(=O)c2cc(OC)c(OC)c(OC)c2O)ccc(O)c1O |
| InChI | InChI=1S/C17H19NO7/c1-18-12-8(5-6-10(19)15(12)22)13(20)9-7-11(23-2)16(24-3)17(25-4)14(9)21/h5-7,18-19,21-22H,1-4H3 |
| InChIKey | IBPJLAPGAPPOJA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|