C26H32O10 — CID 162820672
methyl 2-[6-(furan-3-yl)-10,11,12-trihydroxy-5,15-dimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]-2-hydroxyacetate (PubChem CID 162820672) has the molecular formula C26H32O10 and a molecular weight of 504.53 g/mol. Its IUPAC name is methyl 2-[6-(furan-3-yl)-10,11,12-trihydroxy-5,15-dimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]-2-hydroxyacetate.
| Compound Name | methyl 2-[6-(furan-3-yl)-10,11,12-trihydroxy-5,15-dimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 162820672 |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | methyl 2-[6-(furan-3-yl)-10,11,12-trihydroxy-5,15-dimethyl-8,14-dioxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)C1C2C3CC1(C)C(=O)C3C(O)C1(O)C2CCC2(C)C(c3ccoc3)OC(=O)CC21O |
| InChI | InChI=1S/C26H32O10/c1-23-8-12-15(17(23)18(28)22(31)34-3)13-4-6-24(2)21(11-5-7-35-10-11)36-14(27)9-25(24,32)26(13,33)20(30)16(12)19(23)29/h5,7,10,12-13,15-18,20-21,28,30,32-33H,4,6,8-9H2,1-3H3 |
| InChIKey | HHPPIVUZPOXENM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |