C22H30O5 — CID 162821613
7,17-dihydroxy-16-oxodocosa-4,8,10,12,14,19-hexaenoic acid (PubChem CID 162821613) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is 7,17-dihydroxy-16-oxodocosa-4,8,10,12,14,19-hexaenoic acid.
| Compound Name | 7,17-dihydroxy-16-oxodocosa-4,8,10,12,14,19-hexaenoic acid |
|---|---|
| PubChem CID | 162821613 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 7,17-dihydroxy-16-oxodocosa-4,8,10,12,14,19-hexaenoic acid |
| SMILES | CCC=CCC(O)C(=O)C=CC=CC=CC=CC(O)CC=CCCC(=O)O |
| InChI | InChI=1S/C22H30O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h3-12,14,17,19-20,23-24H,2,13,15-16,18H2,1H3,(H,26,27) |
| InChIKey | CTWAHHIYDLSAPS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|