C31H40O9 — CID 162824736
[2,5-dihydroxy-3-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoyl]oxy-6-methyloxan-4-yl] heptanoate (PubChem CID 162824736) has the molecular formula C31H40O9 and a molecular weight of 556.65 g/mol. Its IUPAC name is [2,5-dihydroxy-3-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoyl]oxy-6-methyloxan-4-yl] heptanoate.
| Compound Name | [2,5-dihydroxy-3-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoyl]oxy-6-methyloxan-4-yl] heptanoate |
|---|---|
| PubChem CID | 162824736 |
| Molecular Formula | C31H40O9 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | [2,5-dihydroxy-3-[2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoyl]oxy-6-methyloxan-4-yl] heptanoate |
| SMILES | CCCCCCC(=O)OC1C(O)C(C)OC(O)C1OC(=O)C(=Cc1ccc(O)c(OC)c1)CCc1ccccc1 |
| InChI | InChI=1S/C31H40O9/c1-4-5-6-10-13-26(33)39-28-27(34)20(2)38-31(36)29(28)40-30(35)23(16-14-21-11-8-7-9-12-21)18-22-15-17-24(32)25(19-22)37-3/h7-9,11-12,15,17-20,27-29,31-32,34,36H,4-6,10,13-14,16H2,1-3H3 |
| InChIKey | ZDNHIDZBQGTZQH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|