C30H39NO10 — CID 162859902
[(2R,3R,4S,5S,6S)-4-acetyloxy-2,5-dihydroxy-6-[2-(methylamino)ethyl]oxan-3-yl] 4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]butanoate (PubChem CID 162859902) has the molecular formula C30H39NO10 and a molecular weight of 573.64 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-4-acetyloxy-2,5-dihydroxy-6-[2-(methylamino)ethyl]oxan-3-yl] 4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]butanoate.
| Compound Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-2,5-dihydroxy-6-[2-(methylamino)ethyl]oxan-3-yl] 4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]butanoate |
|---|---|
| PubChem CID | 162859902 |
| Molecular Formula | C30H39NO10 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-4-acetyloxy-2,5-dihydroxy-6-[2-(methylamino)ethyl]oxan-3-yl] 4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]butanoate |
| SMILES | CNCC[C@@H]1O[C@@H](O)[C@H](OC(=O)C(=Cc2ccc(O)c(OC)c2)CCc2cccc(CCO)c2)[C@@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C30H39NO10/c1-18(33)39-27-26(35)24(11-13-31-2)40-30(37)28(27)41-29(36)22(16-21-8-10-23(34)25(17-21)38-3)9-7-19-5-4-6-20(15-19)12-14-32/h4-6,8,10,15-17,24,26-28,30-32,34-35,37H,7,9,11-14H2,1-3H3/t24-,26-,27-,28+,30+/m0/s1 |
| InChIKey | YMTUMHHQUWOKJM-MDQYPOFQSA-N |
| XLogP | 1.48 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|