C23H31NO9 — CID 163060876
[(1R,5R,6S,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-methylpentanoate (PubChem CID 163060876) has the molecular formula C23H31NO9 and a molecular weight of 465.50 g/mol. Its IUPAC name is [(1R,5R,6S,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-methylpentanoate.
| Compound Name | [(1R,5R,6S,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-methylpentanoate |
|---|---|
| PubChem CID | 163060876 |
| Molecular Formula | C23H31NO9 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | [(1R,5R,6S,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-methylpentanoate |
| SMILES | COc1cc(C=C(CC(C)C)C(=O)O[C@H]2[C@H](OC(C)=O)[C@@H](O)[C@H]3CNC[C@@]2(O)O3)ccc1O |
| InChI | InChI=1S/C23H31NO9/c1-12(2)7-15(8-14-5-6-16(26)17(9-14)30-4)22(28)32-21-20(31-13(3)25)19(27)18-10-24-11-23(21,29)33-18/h5-6,8-9,12,18-21,24,26-27,29H,7,10-11H2,1-4H3/t18-,19+,20-,21+,23-/m1/s1 |
| InChIKey | WPFZSRHPAKBAAT-HVJVJISESA-N |
| XLogP | 0.73 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|