C28H30O9 — CID 163088271
(3-acetyloxy-1,4-dihydroxy-9-oxabicyclo[3.3.1]non-7-en-2-yl) 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoate (PubChem CID 163088271) has the molecular formula C28H30O9 and a molecular weight of 510.54 g/mol. Its IUPAC name is (3-acetyloxy-1,4-dihydroxy-9-oxabicyclo[3.3.1]non-7-en-2-yl) 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoate.
| Compound Name | (3-acetyloxy-1,4-dihydroxy-9-oxabicyclo[3.3.1]non-7-en-2-yl) 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoate |
|---|---|
| PubChem CID | 163088271 |
| Molecular Formula | C28H30O9 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (3-acetyloxy-1,4-dihydroxy-9-oxabicyclo[3.3.1]non-7-en-2-yl) 2-[(4-hydroxy-3-methoxyphenyl)methylidene]-4-phenylbutanoate |
| SMILES | COc1cc(C=C(CCc2ccccc2)C(=O)OC2C(OC(C)=O)C(O)C3CC=CC2(O)O3)ccc1O |
| InChI | InChI=1S/C28H30O9/c1-17(29)35-25-24(31)22-9-6-14-28(33,37-22)26(25)36-27(32)20(12-10-18-7-4-3-5-8-18)15-19-11-13-21(30)23(16-19)34-2/h3-8,11,13-16,22,24-26,30-31,33H,9-10,12H2,1-2H3 |
| InChIKey | STMTUQGSCDZWSN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|