C31H39NO11 — CID 162993832
[(1S,5R,6R,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] (2E,4R)-6-hydroxy-4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hexanoate (PubChem CID 162993832) has the molecular formula C31H39NO11 and a molecular weight of 601.65 g/mol. Its IUPAC name is [(1S,5R,6R,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] (2E,4R)-6-hydroxy-4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hexanoate.
| Compound Name | [(1S,5R,6R,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] (2E,4R)-6-hydroxy-4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hexanoate |
|---|---|
| PubChem CID | 162993832 |
| Molecular Formula | C31H39NO11 |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | [(1S,5R,6R,7R,8S)-7-acetyloxy-5,8-dihydroxy-9-oxa-3-azabicyclo[3.3.1]nonan-6-yl] (2E,4R)-6-hydroxy-4-[3-(2-hydroxyethyl)phenyl]-2-[(4-hydroxy-3-methoxyphenyl)methylidene]hexanoate |
| SMILES | COc1cc(/C=C(\C[C@H](CCO)c2cccc(CCO)c2)C(=O)O[C@@H]2[C@H](OC(C)=O)[C@@H](O)[C@@H]3CNC[C@@]2(O)O3)ccc1O |
| InChI | InChI=1S/C31H39NO11/c1-18(35)41-28-27(37)26-16-32-17-31(39,43-26)29(28)42-30(38)23(13-20-6-7-24(36)25(14-20)40-2)15-22(9-11-34)21-5-3-4-19(12-21)8-10-33/h3-7,12-14,22,26-29,32-34,36-37,39H,8-11,15-17H2,1-2H3/b23-13+/t22-,26-,27-,28+,29+,31+/m0/s1 |
| InChIKey | FOQAPKHPTBMGGH-DIIUQFQISA-N |
| XLogP | 0.77 |
| TPSA | 184.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|