C13H16O5 — CID 175346635
4-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methylidene]pentanoic acid (PubChem CID 175346635) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methylidene]pentanoic acid.
| Compound Name | 4-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methylidene]pentanoic acid |
|---|---|
| PubChem CID | 175346635 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-hydroxy-2-[(4-hydroxy-3-methoxyphenyl)methylidene]pentanoic acid |
| SMILES | COc1cc(C=C(CC(C)O)C(=O)O)ccc1O |
| InChI | InChI=1S/C13H16O5/c1-8(14)5-10(13(16)17)6-9-3-4-11(15)12(7-9)18-2/h3-4,6-8,14-15H,5H2,1-2H3,(H,16,17) |
| InChIKey | ZLMNURMHXKZKHE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|