C14H14O8 — CID 88545845
3-hydroxy-4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxobutanoic acid (PubChem CID 88545845) has the molecular formula C14H14O8 and a molecular weight of 310.26 g/mol. Its IUPAC name is 3-hydroxy-4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxobutanoic acid.
| Compound Name | 3-hydroxy-4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88545845 |
| Molecular Formula | C14H14O8 |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-hydroxy-4-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxobutanoic acid |
| SMILES | COc1cc(C=CC(=O)OC(=O)C(O)CC(=O)O)ccc1O |
| InChI | InChI=1S/C14H14O8/c1-21-11-6-8(2-4-9(11)15)3-5-13(19)22-14(20)10(16)7-12(17)18/h2-6,10,15-16H,7H2,1H3,(H,17,18) |
| InChIKey | PQYFARQIQYESGJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|