C27H33NO9S2 — CID 162827840
11-amino-4,5,6,8,28-pentahydroxy-25-methoxy-21-methyl-2,29-dioxa-15,16-dithiapentacyclo[18.6.2.13,7.08,13.023,27]nonacosa-1(27),9,20(28),21,23,25-hexaen-19-one (PubChem CID 162827840) has the molecular formula C27H33NO9S2 and a molecular weight of 579.69 g/mol. Its IUPAC name is 11-amino-4,5,6,8,28-pentahydroxy-25-methoxy-21-methyl-2,29-dioxa-15,16-dithiapentacyclo[18.6.2.13,7.08,13.023,27]nonacosa-1(27),9,20(28),21,23,25-hexaen-19-one.
| Compound Name | 11-amino-4,5,6,8,28-pentahydroxy-25-methoxy-21-methyl-2,29-dioxa-15,16-dithiapentacyclo[18.6.2.13,7.08,13.023,27]nonacosa-1(27),9,20(28),21,23,25-hexaen-19-one |
|---|---|
| PubChem CID | 162827840 |
| Molecular Formula | C27H33NO9S2 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | 11-amino-4,5,6,8,28-pentahydroxy-25-methoxy-21-methyl-2,29-dioxa-15,16-dithiapentacyclo[18.6.2.13,7.08,13.023,27]nonacosa-1(27),9,20(28),21,23,25-hexaen-19-one |
| SMILES | COc1cc2c3c(O)c(c(C)cc3c1)C(=O)CCSSCC1CC(N)C=CC1(O)C1OC(O2)C(O)C(O)C1O |
| InChI | InChI=1S/C27H33NO9S2/c1-12-7-13-8-16(35-2)10-18-20(13)21(30)19(12)17(29)4-6-38-39-11-14-9-15(28)3-5-27(14,34)25-23(32)22(31)24(33)26(36-18)37-25/h3,5,7-8,10,14-15,22-26,30-34H,4,6,9,11,28H2,1-2H3 |
| InChIKey | AQVGGWCAMOKKPE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|