C28H31NO9 — CID 162835548
11-amino-4,5,6,8,27-pentahydroxy-24-methoxy-20-methyl-2,28-dioxapentacyclo[17.6.2.13,7.08,13.022,26]octacosa-1(26),9,19(27),20,22,24-hexaen-15-yn-18-one (PubChem CID 162835548) has the molecular formula C28H31NO9 and a molecular weight of 525.55 g/mol. Its IUPAC name is 11-amino-4,5,6,8,27-pentahydroxy-24-methoxy-20-methyl-2,28-dioxapentacyclo[17.6.2.13,7.08,13.022,26]octacosa-1(26),9,19(27),20,22,24-hexaen-15-yn-18-one.
| Compound Name | 11-amino-4,5,6,8,27-pentahydroxy-24-methoxy-20-methyl-2,28-dioxapentacyclo[17.6.2.13,7.08,13.022,26]octacosa-1(26),9,19(27),20,22,24-hexaen-15-yn-18-one |
|---|---|
| PubChem CID | 162835548 |
| Molecular Formula | C28H31NO9 |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 11-amino-4,5,6,8,27-pentahydroxy-24-methoxy-20-methyl-2,28-dioxapentacyclo[17.6.2.13,7.08,13.022,26]octacosa-1(26),9,19(27),20,22,24-hexaen-15-yn-18-one |
| SMILES | COc1cc2c3c(O)c(c(C)cc3c1)C(=O)CC#CCC1CC(N)C=CC1(O)C1OC(O2)C(O)C(O)C1O |
| InChI | InChI=1S/C28H31NO9/c1-13-9-14-10-17(36-2)12-19-21(14)22(31)20(13)18(30)6-4-3-5-15-11-16(29)7-8-28(15,35)26-24(33)23(32)25(34)27(37-19)38-26/h7-10,12,15-16,23-27,31-35H,5-6,11,29H2,1-2H3 |
| InChIKey | CJFAHOPHHODRCZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|