C16H16O6 — CID 139193043
(1R,2R,10R,11R,12S,16R)-1,11,16-trihydroxy-6-methoxy-3-oxatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7,14-tetraen-13-one (PubChem CID 139193043) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is (1R,2R,10R,11R,12S,16R)-1,11,16-trihydroxy-6-methoxy-3-oxatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7,14-tetraen-13-one.
| Compound Name | (1R,2R,10R,11R,12S,16R)-1,11,16-trihydroxy-6-methoxy-3-oxatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7,14-tetraen-13-one |
|---|---|
| PubChem CID | 139193043 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (1R,2R,10R,11R,12S,16R)-1,11,16-trihydroxy-6-methoxy-3-oxatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7,14-tetraen-13-one |
| SMILES | COc1ccc2c(c1)O[C@@H]1[C@H]2[C@@H](O)[C@@H]2C(=O)C=C[C@@]1(O)[C@@H]2O |
| InChI | InChI=1S/C16H16O6/c1-21-7-2-3-8-10(6-7)22-15-11(8)13(18)12-9(17)4-5-16(15,20)14(12)19/h2-6,11-15,18-20H,1H3/t11-,12+,13-,14-,15-,16-/m1/s1 |
| InChIKey | LKXLOSAKNGDKSQ-JXEZDRHFSA-N |
| XLogP | -0.24 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |