C26H31NO9 — CID 162955108
(3R,4R,5S,6S,7S,8R,9R)-9-(2-aminoethyl)-4,5,6,8,23-pentahydroxy-20-methoxy-16-methyl-2,24-dioxatetracyclo[13.6.2.13,7.018,22]tetracosa-1(22),15(23),16,18,20-pentaen-11-yn-14-one (PubChem CID 162955108) has the molecular formula C26H31NO9 and a molecular weight of 501.53 g/mol. Its IUPAC name is (3R,4R,5S,6S,7S,8R,9R)-9-(2-aminoethyl)-4,5,6,8,23-pentahydroxy-20-methoxy-16-methyl-2,24-dioxatetracyclo[13.6.2.13,7.018,22]tetracosa-1(22),15(23),16,18,20-pentaen-11-yn-14-one.
| Compound Name | (3R,4R,5S,6S,7S,8R,9R)-9-(2-aminoethyl)-4,5,6,8,23-pentahydroxy-20-methoxy-16-methyl-2,24-dioxatetracyclo[13.6.2.13,7.018,22]tetracosa-1(22),15(23),16,18,20-pentaen-11-yn-14-one |
|---|---|
| PubChem CID | 162955108 |
| Molecular Formula | C26H31NO9 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (3R,4R,5S,6S,7S,8R,9R)-9-(2-aminoethyl)-4,5,6,8,23-pentahydroxy-20-methoxy-16-methyl-2,24-dioxatetracyclo[13.6.2.13,7.018,22]tetracosa-1(22),15(23),16,18,20-pentaen-11-yn-14-one |
| SMILES | COc1cc2c3c(O)c(c(C)cc3c1)C(=O)CC#CC[C@H](CCN)[C@@H](O)[C@@H]1O[C@H](O2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H31NO9/c1-12-9-14-10-15(34-2)11-17-19(14)21(30)18(12)16(28)6-4-3-5-13(7-8-27)20(29)25-23(32)22(31)24(33)26(35-17)36-25/h9-11,13,20,22-26,29-33H,5-8,27H2,1-2H3/t13-,20-,22+,23+,24-,25+,26+/m1/s1 |
| InChIKey | LYSLUSWXJPPPCG-FKFQHFAKSA-N |
| XLogP | 0.35 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|