C32H33NO9 — CID 162909682
14-ethyl-4,5,6,8,30-pentahydroxy-27-methoxy-23-methyl-2,31-dioxa-12-azahexacyclo[20.6.2.13,7.08,16.011,15.025,29]hentriaconta-1(29),9,11(15),13,22(30),23,25,27-octaen-18-yn-21-one (PubChem CID 162909682) has the molecular formula C32H33NO9 and a molecular weight of 575.61 g/mol. Its IUPAC name is 14-ethyl-4,5,6,8,30-pentahydroxy-27-methoxy-23-methyl-2,31-dioxa-12-azahexacyclo[20.6.2.13,7.08,16.011,15.025,29]hentriaconta-1(29),9,11(15),13,22(30),23,25,27-octaen-18-yn-21-one.
| Compound Name | 14-ethyl-4,5,6,8,30-pentahydroxy-27-methoxy-23-methyl-2,31-dioxa-12-azahexacyclo[20.6.2.13,7.08,16.011,15.025,29]hentriaconta-1(29),9,11(15),13,22(30),23,25,27-octaen-18-yn-21-one |
|---|---|
| PubChem CID | 162909682 |
| Molecular Formula | C32H33NO9 |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 14-ethyl-4,5,6,8,30-pentahydroxy-27-methoxy-23-methyl-2,31-dioxa-12-azahexacyclo[20.6.2.13,7.08,16.011,15.025,29]hentriaconta-1(29),9,11(15),13,22(30),23,25,27-octaen-18-yn-21-one |
| SMILES | CCc1c[nH]c2c1C1CC#CCC(=O)c3c(C)cc4cc(OC)cc(c4c3O)OC3OC(C(O)C(O)C3O)C1(O)C=C2 |
| InChI | InChI=1S/C32H33NO9/c1-4-16-14-33-20-9-10-32(39)19(24(16)20)7-5-6-8-21(34)23-15(2)11-17-12-18(40-3)13-22(25(17)26(23)35)41-31-29(38)27(36)28(37)30(32)42-31/h9-14,19,27-31,33,35-39H,4,7-8H2,1-3H3 |
| InChIKey | MWQLNOVNOYEWEF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|