C22H36O2 — CID 162828346
3-[(1R,1'S,4R,6S,7S,10S)-4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl]propan-1-ol (PubChem CID 162828346) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 3-[(1R,1'S,4R,6S,7S,10S)-4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl]propan-1-ol.
| Compound Name | 3-[(1R,1'S,4R,6S,7S,10S)-4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl]propan-1-ol |
|---|---|
| PubChem CID | 162828346 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 3-[(1R,1'S,4R,6S,7S,10S)-4,12,12-trimethyl-9-methylidenespiro[5-oxatricyclo[8.2.0.04,6]dodecane-7,3'-cyclopentane]-1'-yl]propan-1-ol |
| SMILES | C=C1C[C@@]2(CC[C@@H](CCCO)C2)[C@@H]2O[C@]2(C)CC[C@@H]2[C@@H]1CC2(C)C |
| InChI | InChI=1S/C22H36O2/c1-15-12-22(10-7-16(13-22)6-5-11-23)19-21(4,24-19)9-8-18-17(15)14-20(18,2)3/h16-19,23H,1,5-14H2,2-4H3/t16-,17-,18-,19-,21-,22-/m1/s1 |
| InChIKey | WWFQNQDKJOQFIV-OYSQMQRMSA-N |
| XLogP | 5.11 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|