C34H54O2 — CID 163101161
1-[2-[(1R,1'S,3S,4S,7S,9S,10R,11S)-9-cyclohexyl-9-methyl-6-methylidenespiro[2-oxatetracyclo[9.3.1.01,3.07,10]pentadecane-4,3'-cyclopentane]-1'-yl]ethyl]cyclohexan-1-ol (PubChem CID 163101161) has the molecular formula C34H54O2 and a molecular weight of 494.80 g/mol. Its IUPAC name is 1-[2-[(1R,1'S,3S,4S,7S,9S,10R,11S)-9-cyclohexyl-9-methyl-6-methylidenespiro[2-oxatetracyclo[9.3.1.01,3.07,10]pentadecane-4,3'-cyclopentane]-1'-yl]ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[(1R,1'S,3S,4S,7S,9S,10R,11S)-9-cyclohexyl-9-methyl-6-methylidenespiro[2-oxatetracyclo[9.3.1.01,3.07,10]pentadecane-4,3'-cyclopentane]-1'-yl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 163101161 |
| Molecular Formula | C34H54O2 |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | 1-[2-[(1R,1'S,3S,4S,7S,9S,10R,11S)-9-cyclohexyl-9-methyl-6-methylidenespiro[2-oxatetracyclo[9.3.1.01,3.07,10]pentadecane-4,3'-cyclopentane]-1'-yl]ethyl]cyclohexan-1-ol |
| SMILES | C=C1C[C@@]2(CC[C@@H](CCC3(O)CCCCC3)C2)[C@@H]2O[C@@]23CCC[C@@H](C3)[C@@H]2[C@@H]1C[C@@]2(C)C1CCCCC1 |
| InChI | InChI=1S/C34H54O2/c1-24-20-32(18-13-25(21-32)14-19-33(35)15-7-4-8-16-33)30-34(36-30)17-9-10-26(22-34)29-28(24)23-31(29,2)27-11-5-3-6-12-27/h25-30,35H,1,3-23H2,2H3/t25-,26-,28+,29+,30-,31-,32+,34+/m0/s1 |
| InChIKey | HCAYWULUVHVYJQ-SEJZZQETSA-N |
| XLogP | 8.76 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|