C18H26O9 — CID 162828416
(3S,4aS,5R,6S)-5-ethenyl-3-methyl-6-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one (PubChem CID 162828416) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is (3S,4aS,5R,6S)-5-ethenyl-3-methyl-6-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one.
| Compound Name | (3S,4aS,5R,6S)-5-ethenyl-3-methyl-6-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one |
|---|---|
| PubChem CID | 162828416 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (3S,4aS,5R,6S)-5-ethenyl-3-methyl-6-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-6-methyloxan-2-yl]oxy-4,4a,5,6-tetrahydro-3H-pyrano[3,4-c]pyran-1-one |
| SMILES | C=C[C@H]1[C@H](O[C@@H]2O[C@](C)(CO)[C@H](O)[C@@H](O)[C@H]2O)OC=C2C(=O)O[C@@H](C)C[C@H]21 |
| InChI | InChI=1S/C18H26O9/c1-4-9-10-5-8(2)25-15(23)11(10)6-24-16(9)26-17-13(21)12(20)14(22)18(3,7-19)27-17/h4,6,8-10,12-14,16-17,19-22H,1,5,7H2,2-3H3/t8-,9+,10-,12-,13+,14+,16-,17+,18+/m0/s1 |
| InChIKey | HQHAUQRVWKIINB-WTZPVYJTSA-N |
| XLogP | -0.81 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|