C22H19NO10 — CID 162842316
14-hydroxy-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one (PubChem CID 162842316) has the molecular formula C22H19NO10 and a molecular weight of 457.39 g/mol. Its IUPAC name is 14-hydroxy-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one.
| Compound Name | 14-hydroxy-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 162842316 |
| Molecular Formula | C22H19NO10 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 14-hydroxy-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dioxa-10-azapentacyclo[9.7.1.02,6.08,19.013,18]nonadeca-1(18),2(6),7,11(19),12,14,16-heptaen-9-one |
| SMILES | O=C1c2cc3c(c4c2c(cc2c(O)cccc24)N1OC1OC(CO)C(O)C(O)C1O)OCO3 |
| InChI | InChI=1S/C22H19NO10/c24-6-14-17(26)18(27)19(28)22(32-14)33-23-11-4-9-8(2-1-3-12(9)25)16-15(11)10(21(23)29)5-13-20(16)31-7-30-13/h1-5,14,17-19,22,24-28H,6-7H2 |
| InChIKey | CTRAEQXVVYQKSX-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 158.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|