C22H20NO12- — CID 163126364
6-(dihydroxyamino)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate (PubChem CID 163126364) has the molecular formula C22H20NO12- and a molecular weight of 490.40 g/mol. Its IUPAC name is 6-(dihydroxyamino)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate.
| Compound Name | 6-(dihydroxyamino)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 163126364 |
| Molecular Formula | C22H20NO12- |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 6-(dihydroxyamino)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxynaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
| SMILES | O=C([O-])c1cc2c(c3c1c(N(O)O)cc1ccc(OC4OC(CO)C(O)C(O)C4O)cc13)OCO2 |
| InChI | InChI=1S/C22H21NO12/c24-6-14-17(25)18(26)19(27)22(35-14)34-9-2-1-8-3-12(23(30)31)15-11(21(28)29)5-13-20(33-7-32-13)16(15)10(8)4-9/h1-5,14,17-19,22,24-27,30-31H,6-7H2,(H,28,29)/p-1 |
| InChIKey | NHLMPQGXHFQYFQ-UHFFFAOYSA-M |
| XLogP | -1.15 |
| TPSA | 201.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|