C24H29NO3 — CID 162843394
N-[(2S)-2-methoxy-2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-3-phenylprop-2-enamide (PubChem CID 162843394) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[(2S)-2-methoxy-2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | N-[(2S)-2-methoxy-2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 162843394 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[(2S)-2-methoxy-2-[4-(4-methylpent-3-enoxy)phenyl]ethyl]-3-phenylprop-2-enamide |
| SMILES | CO[C@H](CNC(=O)C=Cc1ccccc1)c1ccc(OCCC=C(C)C)cc1 |
| InChI | InChI=1S/C24H29NO3/c1-19(2)8-7-17-28-22-14-12-21(13-15-22)23(27-3)18-25-24(26)16-11-20-9-5-4-6-10-20/h4-6,8-16,23H,7,17-18H2,1-3H3,(H,25,26)/t23-/m1/s1 |
| InChIKey | IBBVKHJRQTXWQU-HSZRJFAPSA-N |
| XLogP | 4.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|