About 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol
4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol (PubChem CID 162845079) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol.
Analyze 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol?
The IUPAC name of 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol (CID 162845079) is 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol.
What is the SMILES notation for 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol?
The canonical SMILES for 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol is OC1COC2(COC3(CO2)CC(O)CO3)C1.
What is the InChIKey of 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol?
The InChIKey is MFWNKUIDGSGXMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O6/c11-7-1-9(13-3-7)5-16-10(6-15-9)2-8(12)4-14-10/h7-8,11-12H,1-6H2.
What are the key properties of 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol?
4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol has a molecular weight of 232.23 g/mol, XLogP of -1.01, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7,12,14-tetraoxadispiro[4.2.48.25]tetradecane-2,10-diol is sourced from PubChem (CID 162845079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).