C18H28O4 — CID 162846542
methyl 2-[(1R,4R,4aR,6S,8aR)-4-ethoxy-6-hydroxy-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]prop-2-enoate (PubChem CID 162846542) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is methyl 2-[(1R,4R,4aR,6S,8aR)-4-ethoxy-6-hydroxy-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1R,4R,4aR,6S,8aR)-4-ethoxy-6-hydroxy-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162846542 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | methyl 2-[(1R,4R,4aR,6S,8aR)-4-ethoxy-6-hydroxy-4,7-dimethyl-2,3,4a,5,6,8a-hexahydro-1H-naphthalen-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@](C)(OCC)[C@@H]2C[C@H](O)C(C)=C[C@@H]21 |
| InChI | InChI=1S/C18H28O4/c1-6-22-18(4)8-7-13(12(3)17(20)21-5)14-9-11(2)16(19)10-15(14)18/h9,13-16,19H,3,6-8,10H2,1-2,4-5H3/t13-,14+,15+,16-,18+/m0/s1 |
| InChIKey | MANZEPPAFJOHLB-VNIVASGNSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|