C21H28O5 — CID 162847502
(2R,4aR,10aS)-6,8-dihydroxy-7-(2-hydroxypropan-2-yl)-5-methoxy-2,4a-dimethyl-1-methylidene-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (PubChem CID 162847502) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2R,4aR,10aS)-6,8-dihydroxy-7-(2-hydroxypropan-2-yl)-5-methoxy-2,4a-dimethyl-1-methylidene-3,4,10,10a-tetrahydro-2H-phenanthren-9-one.
| Compound Name | (2R,4aR,10aS)-6,8-dihydroxy-7-(2-hydroxypropan-2-yl)-5-methoxy-2,4a-dimethyl-1-methylidene-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 162847502 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (2R,4aR,10aS)-6,8-dihydroxy-7-(2-hydroxypropan-2-yl)-5-methoxy-2,4a-dimethyl-1-methylidene-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| SMILES | C=C1[C@H](C)CC[C@@]2(C)c3c(OC)c(O)c(C(C)(C)O)c(O)c3C(=O)C[C@@H]12 |
| InChI | InChI=1S/C21H28O5/c1-10-7-8-21(5)12(11(10)2)9-13(22)14-15(21)19(26-6)18(24)16(17(14)23)20(3,4)25/h10,12,23-25H,2,7-9H2,1,3-6H3/t10-,12+,21-/m1/s1 |
| InChIKey | NHLQPIOUCQBSFL-SXUOVDMSSA-N |
| XLogP | 3.78 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|