C25H40N2O5 — CID 162849577
(2E,4E,6R)-6-hydroxy-N-[5-[[(2E,4E,6R)-6-hydroxy-3-methylhepta-2,4-dienoyl]amino]-2,2,4,4-tetramethyl-3-oxopentyl]-3-methylhepta-2,4-dienamide (PubChem CID 162849577) has the molecular formula C25H40N2O5 and a molecular weight of 448.60 g/mol. Its IUPAC name is (2E,4E,6R)-6-hydroxy-N-[5-[[(2E,4E,6R)-6-hydroxy-3-methylhepta-2,4-dienoyl]amino]-2,2,4,4-tetramethyl-3-oxopentyl]-3-methylhepta-2,4-dienamide.
| Compound Name | (2E,4E,6R)-6-hydroxy-N-[5-[[(2E,4E,6R)-6-hydroxy-3-methylhepta-2,4-dienoyl]amino]-2,2,4,4-tetramethyl-3-oxopentyl]-3-methylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 162849577 |
| Molecular Formula | C25H40N2O5 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | (2E,4E,6R)-6-hydroxy-N-[5-[[(2E,4E,6R)-6-hydroxy-3-methylhepta-2,4-dienoyl]amino]-2,2,4,4-tetramethyl-3-oxopentyl]-3-methylhepta-2,4-dienamide |
| SMILES | CC(/C=C/[C@@H](C)O)=C\C(=O)NCC(C)(C)C(=O)C(C)(C)CNC(=O)/C=C(C)/C=C/[C@@H](C)O |
| InChI | InChI=1S/C25H40N2O5/c1-17(9-11-19(3)28)13-21(30)26-15-24(5,6)23(32)25(7,8)16-27-22(31)14-18(2)10-12-20(4)29/h9-14,19-20,28-29H,15-16H2,1-8H3,(H,26,30)(H,27,31)/b11-9+,12-10+,17-13+,18-14+/t19-,20-/m1/s1 |
| InChIKey | QWDUIMTWTQIEFM-BTVGQRCLSA-N |
| XLogP | 2.61 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|