C28H22O7 — CID 162851479
(1R,8S,9S,16R)-8-(2,4-dihydroxyphenyl)-16-(4-hydroxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol (PubChem CID 162851479) has the molecular formula C28H22O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is (1R,8S,9S,16R)-8-(2,4-dihydroxyphenyl)-16-(4-hydroxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol.
| Compound Name | (1R,8S,9S,16R)-8-(2,4-dihydroxyphenyl)-16-(4-hydroxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol |
|---|---|
| PubChem CID | 162851479 |
| Molecular Formula | C28H22O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | (1R,8S,9S,16R)-8-(2,4-dihydroxyphenyl)-16-(4-hydroxyphenyl)tetracyclo[7.6.1.02,7.010,15]hexadeca-2(7),3,5,10(15),11,13-hexaene-4,6,12,14-tetrol |
| SMILES | Oc1ccc([C@H]2[C@@H]3c4cc(O)cc(O)c4[C@H](c4ccc(O)cc4O)[C@H]2c2cc(O)cc(O)c23)cc1 |
| InChI | InChI=1S/C28H22O7/c29-13-3-1-12(2-4-13)23-27-18-7-15(31)10-21(34)24(18)26(17-6-5-14(30)9-20(17)33)28(23)19-8-16(32)11-22(35)25(19)27/h1-11,23,26-35H/t23-,26-,27-,28-/m0/s1 |
| InChIKey | GNSJZCNHHBQAHE-WHHDSKRTSA-N |
| XLogP | 4.78 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |