C32H38N2O8 — CID 162852213
(3S,4R)-13-(ethylaminomethoxy)-4-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12,14,16(20)-hexaen-3-ol (PubChem CID 162852213) has the molecular formula C32H38N2O8 and a molecular weight of 578.66 g/mol. Its IUPAC name is (3S,4R)-13-(ethylaminomethoxy)-4-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12,14,16(20)-hexaen-3-ol.
| Compound Name | (3S,4R)-13-(ethylaminomethoxy)-4-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12,14,16(20)-hexaen-3-ol |
|---|---|
| PubChem CID | 162852213 |
| Molecular Formula | C32H38N2O8 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | (3S,4R)-13-(ethylaminomethoxy)-4-[4-hydroxy-3-(3-hydroxypropoxy)-5-methoxyphenyl]-15-methoxy-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12,14,16(20)-hexaen-3-ol |
| SMILES | CCNCOc1cc(OC)c2c3c1CNc1cc4c(c(c1-3)CC2)[C@@H](O)[C@H](c1cc(OC)c(O)c(OCCCO)c1)CO4 |
| InChI | InChI=1S/C32H38N2O8/c1-4-33-16-42-24-13-23(38-2)18-6-7-19-29-22(34-14-20(24)28(18)29)12-25-30(19)31(36)21(15-41-25)17-10-26(39-3)32(37)27(11-17)40-9-5-8-35/h10-13,21,31,33-37H,4-9,14-16H2,1-3H3/t21-,31-/m0/s1 |
| InChIKey | ZLZPODWUSOWXIZ-BGOLNKOXSA-N |
| XLogP | 4.02 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|