C34H33NO8 — CID 162984248
(3S,4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-15-[[3-(hydroxymethyl)phenyl]methoxy]-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol (PubChem CID 162984248) has the molecular formula C34H33NO8 and a molecular weight of 583.64 g/mol. Its IUPAC name is (3S,4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-15-[[3-(hydroxymethyl)phenyl]methoxy]-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol.
| Compound Name | (3S,4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-15-[[3-(hydroxymethyl)phenyl]methoxy]-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol |
|---|---|
| PubChem CID | 162984248 |
| Molecular Formula | C34H33NO8 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | (3S,4R)-4-(4-hydroxy-3,5-dimethoxyphenyl)-15-[[3-(hydroxymethyl)phenyl]methoxy]-6-oxa-10-azapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),8,12(20),13,15-hexaene-3,13-diol |
| SMILES | COc1cc([C@@H]2COc3cc4c5c(c3[C@H]2O)CCc2c(OCc3cccc(CO)c3)cc(O)c(c2-5)CN4)cc(OC)c1O |
| InChI | InChI=1S/C34H33NO8/c1-40-28-9-19(10-29(41-2)34(28)39)23-16-43-27-11-24-31-21(32(27)33(23)38)7-6-20-26(12-25(37)22(13-35-24)30(20)31)42-15-18-5-3-4-17(8-18)14-36/h3-5,8-12,23,33,35-39H,6-7,13-16H2,1-2H3/t23-,33-/m0/s1 |
| InChIKey | MCAHEZBKRWOGLQ-WYOOIXGGSA-N |
| XLogP | 5.09 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|