C26H26O8 — CID 162861385
(3R,4S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9,11-triol (PubChem CID 162861385) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is (3R,4S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9,11-triol.
| Compound Name | (3R,4S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9,11-triol |
|---|---|
| PubChem CID | 162861385 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (3R,4S)-3-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-4,9,11-triol |
| SMILES | COc1cc([C@@H]2COc3cc(O)c4c(c3[C@H]2O)CCc2c(OC)cc(O)cc2-4)cc(OC)c1O |
| InChI | InChI=1S/C26H26O8/c1-31-19-9-13(27)8-16-14(19)4-5-15-23(16)18(28)10-20-24(15)25(29)17(11-34-20)12-6-21(32-2)26(30)22(7-12)33-3/h6-10,17,25,27-30H,4-5,11H2,1-3H3/t17-,25-/m0/s1 |
| InChIKey | ZGGKRHUVAUUVSM-GKVSMKOHSA-N |
| XLogP | 3.80 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |