C14H16O2S — CID 162856872
5-(5-methylthiophen-2-yl)pent-2-en-4-ynyl 2-methylpropanoate (PubChem CID 162856872) has the molecular formula C14H16O2S and a molecular weight of 248.35 g/mol. Its IUPAC name is 5-(5-methylthiophen-2-yl)pent-2-en-4-ynyl 2-methylpropanoate.
| Compound Name | 5-(5-methylthiophen-2-yl)pent-2-en-4-ynyl 2-methylpropanoate |
|---|---|
| PubChem CID | 162856872 |
| Molecular Formula | C14H16O2S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 5-(5-methylthiophen-2-yl)pent-2-en-4-ynyl 2-methylpropanoate |
| SMILES | Cc1ccc(C#CC=CCOC(=O)C(C)C)s1 |
| InChI | InChI=1S/C14H16O2S/c1-11(2)14(15)16-10-6-4-5-7-13-9-8-12(3)17-13/h4,6,8-9,11H,10H2,1-3H3 |
| InChIKey | CTYCJIYJQUIHLJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|