C15H12OS2 — CID 91751060
1-[5-(5-but-3-en-1-ynylthiophen-2-yl)thiophen-2-yl]propan-2-one (PubChem CID 91751060) has the molecular formula C15H12OS2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-[5-(5-but-3-en-1-ynylthiophen-2-yl)thiophen-2-yl]propan-2-one.
| Compound Name | 1-[5-(5-but-3-en-1-ynylthiophen-2-yl)thiophen-2-yl]propan-2-one |
|---|---|
| PubChem CID | 91751060 |
| Molecular Formula | C15H12OS2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 1-[5-(5-but-3-en-1-ynylthiophen-2-yl)thiophen-2-yl]propan-2-one |
| SMILES | C=CC#Cc1ccc(-c2ccc(CC(C)=O)s2)s1 |
| InChI | InChI=1S/C15H12OS2/c1-3-4-5-12-6-8-14(17-12)15-9-7-13(18-15)10-11(2)16/h3,6-9H,1,10H2,2H3 |
| InChIKey | YINMMFXHFCEWCK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|