C21H36O4 — CID 162868706
(1R,2R,4R,6E,8S,12S)-4-methyl-11,15-dimethylidene-8-propan-2-ylcyclopentadec-6-ene-1,2,4,12-tetrol (PubChem CID 162868706) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is (1R,2R,4R,6E,8S,12S)-4-methyl-11,15-dimethylidene-8-propan-2-ylcyclopentadec-6-ene-1,2,4,12-tetrol.
| Compound Name | (1R,2R,4R,6E,8S,12S)-4-methyl-11,15-dimethylidene-8-propan-2-ylcyclopentadec-6-ene-1,2,4,12-tetrol |
|---|---|
| PubChem CID | 162868706 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (1R,2R,4R,6E,8S,12S)-4-methyl-11,15-dimethylidene-8-propan-2-ylcyclopentadec-6-ene-1,2,4,12-tetrol |
| SMILES | C=C1CC[C@H](O)C(=C)CC[C@@H](C(C)C)/C=C/C[C@@](C)(O)C[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H36O4/c1-14(2)17-7-6-12-21(5,25)13-19(23)20(24)16(4)9-11-18(22)15(3)8-10-17/h6-7,14,17-20,22-25H,3-4,8-13H2,1-2,5H3/b7-6+/t17-,18-,19+,20+,21+/m0/s1 |
| InChIKey | VWTJAPTYTKEMSK-VYBHUOEBSA-N |
| XLogP | 3.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|