C23H30O7 — CID 162871612
(2R,3S,3aS,5S)-5,7-dimethoxy-2-methyl-3a-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3,4,5-tetrahydro-1-benzofuran-6-one (PubChem CID 162871612) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is (2R,3S,3aS,5S)-5,7-dimethoxy-2-methyl-3a-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3,4,5-tetrahydro-1-benzofuran-6-one.
| Compound Name | (2R,3S,3aS,5S)-5,7-dimethoxy-2-methyl-3a-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3,4,5-tetrahydro-1-benzofuran-6-one |
|---|---|
| PubChem CID | 162871612 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (2R,3S,3aS,5S)-5,7-dimethoxy-2-methyl-3a-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3,4,5-tetrahydro-1-benzofuran-6-one |
| SMILES | C=CC[C@@]12C[C@H](OC)C(=O)C(OC)=C1O[C@H](C)[C@H]2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30O7/c1-8-9-23-12-17(27-5)19(24)21(29-7)22(23)30-13(2)18(23)14-10-15(25-3)20(28-6)16(11-14)26-4/h8,10-11,13,17-18H,1,9,12H2,2-7H3/t13-,17+,18+,23+/m1/s1 |
| InChIKey | CSKJIGAKZXQTFO-OFBGFOQGSA-N |
| XLogP | 3.62 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|