C25H42O5 — CID 162873010
[(2R)-3-acetyloxy-2-hydroxypropyl] (3R)-5-[(4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate (PubChem CID 162873010) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is [(2R)-3-acetyloxy-2-hydroxypropyl] (3R)-5-[(4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate.
| Compound Name | [(2R)-3-acetyloxy-2-hydroxypropyl] (3R)-5-[(4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 162873010 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | [(2R)-3-acetyloxy-2-hydroxypropyl] (3R)-5-[(4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoate |
| SMILES | CC(=O)OC[C@@H](O)COC(=O)C[C@H](C)CCC1=C(C)CC[C@@H]2C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C25H42O5/c1-17(14-23(28)30-16-20(27)15-29-19(3)26)8-10-21-18(2)9-11-22-24(4,5)12-7-13-25(21,22)6/h17,20,22,27H,7-16H2,1-6H3/t17-,20-,22-,25+/m1/s1 |
| InChIKey | BFUQQIDOPSTXTF-KJFBJOSPSA-N |
| XLogP | 5.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|