C21H34O4 — CID 162880847
methyl (Z)-7-[(2S,4aR,5R,7aR)-6-oxo-2-pentyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran-5-yl]hept-5-enoate (PubChem CID 162880847) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (Z)-7-[(2S,4aR,5R,7aR)-6-oxo-2-pentyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran-5-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2S,4aR,5R,7aR)-6-oxo-2-pentyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran-5-yl]hept-5-enoate |
|---|---|
| PubChem CID | 162880847 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (Z)-7-[(2S,4aR,5R,7aR)-6-oxo-2-pentyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran-5-yl]hept-5-enoate |
| SMILES | CCCCC[C@H]1CC[C@H]2[C@@H](CC(=O)[C@@H]2C/C=C\CCCC(=O)OC)O1 |
| InChI | InChI=1S/C21H34O4/c1-3-4-7-10-16-13-14-18-17(19(22)15-20(18)25-16)11-8-5-6-9-12-21(23)24-2/h5,8,16-18,20H,3-4,6-7,9-15H2,1-2H3/b8-5-/t16-,17+,18+,20+/m0/s1 |
| InChIKey | FCMFHXNVRJAYJM-IRRXTAOVSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|