C22H30O5 — CID 162885859
[(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] 2-methylbut-2-enoate (PubChem CID 162885859) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] 2-methylbut-2-enoate.
| Compound Name | [(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162885859 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(3S)-2-(2-hydroxy-3,5-dimethoxy-4-methylphenyl)-6-methylhepta-1,5-dien-3-yl] 2-methylbut-2-enoate |
| SMILES | C=C(c1cc(OC)c(C)c(OC)c1O)[C@H](CC=C(C)C)OC(=O)C(C)=CC |
| InChI | InChI=1S/C22H30O5/c1-9-14(4)22(24)27-18(11-10-13(2)3)15(5)17-12-19(25-7)16(6)21(26-8)20(17)23/h9-10,12,18,23H,5,11H2,1-4,6-8H3/t18-/m0/s1 |
| InChIKey | WSFSOZDLQDYURS-SFHVURJKSA-N |
| XLogP | 4.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|