C20H34O3 — CID 162892876
(3S,3aS,4Z,6S,8E,12R,12aR)-3,8,12-trimethyl-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6,12-triol (PubChem CID 162892876) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (3S,3aS,4Z,6S,8E,12R,12aR)-3,8,12-trimethyl-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6,12-triol.
| Compound Name | (3S,3aS,4Z,6S,8E,12R,12aR)-3,8,12-trimethyl-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6,12-triol |
|---|---|
| PubChem CID | 162892876 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (3S,3aS,4Z,6S,8E,12R,12aR)-3,8,12-trimethyl-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6,12-triol |
| SMILES | C/C1=C\CC[C@@](C)(O)[C@@H]2CC[C@](C)(O)[C@H]2/C=C(/C(C)C)[C@@H](O)C1 |
| InChI | InChI=1S/C20H34O3/c1-13(2)15-12-17-16(8-10-20(17,5)23)19(4,22)9-6-7-14(3)11-18(15)21/h7,12-13,16-18,21-23H,6,8-11H2,1-5H3/b14-7+,15-12-/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | JZJHWIXAXMORLY-SOCNZVHLSA-N |
| XLogP | 3.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|