C25H38O7 — CID 162893310
[(2R,3R)-2-[(2S,4R)-5-[(2S,3R)-2,3-dimethyloxiran-2-yl]-4-methylpentan-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate (PubChem CID 162893310) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(2R,3R)-2-[(2S,4R)-5-[(2S,3R)-2,3-dimethyloxiran-2-yl]-4-methylpentan-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate.
| Compound Name | [(2R,3R)-2-[(2S,4R)-5-[(2S,3R)-2,3-dimethyloxiran-2-yl]-4-methylpentan-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 162893310 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(2R,3R)-2-[(2S,4R)-5-[(2S,3R)-2,3-dimethyloxiran-2-yl]-4-methylpentan-2-yl]-6-oxo-2,3-dihydropyran-3-yl] (2E,4E,6S)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate |
| SMILES | CC(/C=C/C(=O)O[C@@H]1C=CC(=O)O[C@@H]1[C@@H](C)C[C@@H](C)C[C@]1(C)O[C@@H]1C)=C\[C@@H](CO)CCO |
| InChI | InChI=1S/C25H38O7/c1-16(13-20(15-27)10-11-26)6-8-22(28)30-21-7-9-23(29)31-24(21)18(3)12-17(2)14-25(5)19(4)32-25/h6-9,13,17-21,24,26-27H,10-12,14-15H2,1-5H3/b8-6+,16-13+/t17-,18+,19-,20+,21-,24-,25+/m1/s1 |
| InChIKey | AOHWBVWZGFQODA-SFICGUHBSA-N |
| XLogP | 3.10 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|