About (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one
(2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one (PubChem CID 135044590) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one |
| PubChem CID | 135044590 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one |
| SMILES | CC(=O)C[C@H](C)C[C@H](O)[C@@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C11H16O4/c1-7(5-8(2)12)6-9(13)10-3-4-11(14)15-10/h3-4,7,9-10,13H,5-6H2,1-2H3/t7-,9-,10-/m0/s1 |
| InChIKey | LRNBNKHHDQLTLD-HGNGGELXSA-N |
| XLogP | 0.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one?
The IUPAC name of (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one (CID 135044590) is (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one.
What is the SMILES notation for (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one?
The canonical SMILES for (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one is CC(=O)C[C@H](C)C[C@H](O)[C@@H]1C=CC(=O)O1.
What is the InChIKey of (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one?
The InChIKey is LRNBNKHHDQLTLD-HGNGGELXSA-N. The full InChI is InChI=1S/C11H16O4/c1-7(5-8(2)12)6-9(13)10-3-4-11(14)15-10/h3-4,7,9-10,13H,5-6H2,1-2H3/t7-,9-,10-/m0/s1.
What are the key properties of (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one?
(2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one has a molecular weight of 212.24 g/mol, XLogP of 0.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1S,3R)-1-hydroxy-3-methyl-5-oxohexyl]-2H-furan-5-one is sourced from PubChem (CID 135044590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).