C19H24O4 — CID 162893339
3-[(2S)-2-[(2S)-1-hydroxypropan-2-yl]-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoic acid (PubChem CID 162893339) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[(2S)-2-[(2S)-1-hydroxypropan-2-yl]-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoic acid.
| Compound Name | 3-[(2S)-2-[(2S)-1-hydroxypropan-2-yl]-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162893339 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-[(2S)-2-[(2S)-1-hydroxypropan-2-yl]-7-(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoic acid |
| SMILES | CC(C)=CCc1cc(C=CC(=O)O)cc2c1O[C@H]([C@@H](C)CO)C2 |
| InChI | InChI=1S/C19H24O4/c1-12(2)4-6-15-8-14(5-7-18(21)22)9-16-10-17(13(3)11-20)23-19(15)16/h4-5,7-9,13,17,20H,6,10-11H2,1-3H3,(H,21,22)/t13-,17-/m0/s1 |
| InChIKey | IJQHPPUNNDWTDR-GUYCJALGSA-N |
| XLogP | 3.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|