C28H40O9 — CID 162893793
[(1S,2R,5R,10R,11S,14R,16S,17R,20S,21S,22R)-11,16,21-trihydroxy-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricosa-8,12-dien-17-yl] acetate (PubChem CID 162893793) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(1S,2R,5R,10R,11S,14R,16S,17R,20S,21S,22R)-11,16,21-trihydroxy-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricosa-8,12-dien-17-yl] acetate.
| Compound Name | [(1S,2R,5R,10R,11S,14R,16S,17R,20S,21S,22R)-11,16,21-trihydroxy-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricosa-8,12-dien-17-yl] acetate |
|---|---|
| PubChem CID | 162893793 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(1S,2R,5R,10R,11S,14R,16S,17R,20S,21S,22R)-11,16,21-trihydroxy-14-methoxy-2,5-dimethyl-8-propan-2-yl-15,19,23-trioxahexacyclo[18.2.1.02,10.05,9.013,22.016,21]tricosa-8,12-dien-17-yl] acetate |
| SMILES | CO[C@@H]1O[C@@]2(O)[C@H](OC(C)=O)CO[C@H]3O[C@H]4[C@@H](C1=C[C@H](O)[C@@H]1C5=C(C(C)C)CC[C@]5(C)CC[C@@]41C)[C@]32O |
| InChI | InChI=1S/C28H40O9/c1-13(2)15-7-8-25(4)9-10-26(5)21(19(15)25)17(30)11-16-20-22(26)36-24-27(20,31)28(32,37-23(16)33-6)18(12-34-24)35-14(3)29/h11,13,17-18,20-24,30-32H,7-10,12H2,1-6H3/t17-,18+,20+,21+,22-,23+,24-,25+,26+,27-,28-/m0/s1 |
| InChIKey | YUNYLSVPLWHYCC-HDGISTPKSA-N |
| XLogP | 2.18 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|