C22H35NO7 — CID 162894124
(1R,2R,3S,4S,5R,6R,8S,9S,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13,14,16-pentol (PubChem CID 162894124) has the molecular formula C22H35NO7 and a molecular weight of 425.52 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R,6R,8S,9S,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13,14,16-pentol.
| Compound Name | (1R,2R,3S,4S,5R,6R,8S,9S,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13,14,16-pentol |
|---|---|
| PubChem CID | 162894124 |
| Molecular Formula | C22H35NO7 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (1R,2R,3S,4S,5R,6R,8S,9S,10S,13S,14R,16S,17S)-11-ethyl-4,6-dimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,8,13,14,16-pentol |
| SMILES | CCN1C[C@]2(O)[C@H](O)C[C@H](O)[C@]34[C@@H]1[C@H](C[C@H]23)[C@@]1(O)C[C@@H](OC)[C@H]2C[C@H]4[C@]1(O)[C@H]2OC |
| InChI | InChI=1S/C22H35NO7/c1-4-23-9-19(26)13-6-11-17(23)21(13,16(25)7-15(19)24)14-5-10-12(29-2)8-20(11,27)22(14,28)18(10)30-3/h10-18,24-28H,4-9H2,1-3H3/t10-,11+,12-,13-,14-,15-,16+,17+,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | ZXJSAXUDNWYOEW-BCXYLZRBSA-N |
| XLogP | -1.28 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |