C22H35NO5 — CID 177434267
(1S,2R,3R,4S,5S,6S,8S,9S,13R,14R,16S,17R)-11-ethyl-6-methoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,14,16-tetrol (PubChem CID 177434267) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is (1S,2R,3R,4S,5S,6S,8S,9S,13R,14R,16S,17R)-11-ethyl-6-methoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,14,16-tetrol.
| Compound Name | (1S,2R,3R,4S,5S,6S,8S,9S,13R,14R,16S,17R)-11-ethyl-6-methoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,14,16-tetrol |
|---|---|
| PubChem CID | 177434267 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (1S,2R,3R,4S,5S,6S,8S,9S,13R,14R,16S,17R)-11-ethyl-6-methoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,14,16-tetrol |
| SMILES | CCN1C[C@]2(C)[C@H](O)C[C@H](O)[C@]34C1[C@H](C[C@H]23)[C@@]1(O)C[C@H](OC)[C@H]2C[C@@H]4[C@@H]1[C@H]2O |
| InChI | InChI=1S/C22H35NO5/c1-4-23-9-20(2)14-6-12-19(23)22(14,16(25)7-15(20)24)11-5-10-13(28-3)8-21(12,27)17(11)18(10)26/h10-19,24-27H,4-9H2,1-3H3/t10-,11-,12+,13+,14-,15-,16+,17-,18+,19?,20+,21+,22-/m1/s1 |
| InChIKey | UIPGOYCEMUDIGT-LKNKQPKSSA-N |
| XLogP | 0.22 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |