C24H39NO6 — CID 177412975
(1S,4S,5S,6S,8S,9S,10R,13S,16S,17S)-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,17-triol (PubChem CID 177412975) has the molecular formula C24H39NO6 and a molecular weight of 437.58 g/mol. Its IUPAC name is (1S,4S,5S,6S,8S,9S,10R,13S,16S,17S)-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,17-triol.
| Compound Name | (1S,4S,5S,6S,8S,9S,10R,13S,16S,17S)-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,17-triol |
|---|---|
| PubChem CID | 177412975 |
| Molecular Formula | C24H39NO6 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (1S,4S,5S,6S,8S,9S,10R,13S,16S,17S)-11-ethyl-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8,17-triol |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34C5C[C@H]6C(O)C5[C@](O)(C[C@@H]6OC)[C@@H](C[C@]23O)[C@@H]14 |
| InChI | InChI=1S/C24H39NO6/c1-5-25-11-21(12-29-2)7-6-17(31-4)24-14-8-13-16(30-3)10-22(27,18(14)19(13)26)15(20(24)25)9-23(21,24)28/h13-20,26-28H,5-12H2,1-4H3/t13-,14?,15+,16+,17+,18?,19?,20-,21+,22+,23+,24-/m1/s1 |
| InChIKey | GHJSAGLOVATBKI-QGVGQPRESA-N |
| XLogP | 0.65 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |