C23H37NO5 — CID 162420180
(2R,4S,5S)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,6,8-triol (PubChem CID 162420180) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is (2R,4S,5S)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,6,8-triol.
| Compound Name | (2R,4S,5S)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,6,8-triol |
|---|---|
| PubChem CID | 162420180 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | (2R,4S,5S)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,6,8-triol |
| SMILES | CCN1CC2(COC)CCC(OC)C34C1C(CC23)C1(O)CC(O)[C@@H]2C[C@@H]4C1C2O |
| InChI | InChI=1S/C23H37NO5/c1-4-24-10-21(11-28-2)6-5-17(29-3)23-13-7-12-15(25)9-22(27,18(13)19(12)26)14(20(23)24)8-16(21)23/h12-20,25-27H,4-11H2,1-3H3/t12-,13+,14?,15?,16?,17?,18?,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | LOVWCJHAEAJUMS-IDOHTZMSSA-N |
| XLogP | 0.88 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |