C23H35NO4 — CID 146166589
(3S,4S,5R,8S,9S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-6-ene-4,8-diol (PubChem CID 146166589) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is (3S,4S,5R,8S,9S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-6-ene-4,8-diol.
| Compound Name | (3S,4S,5R,8S,9S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-6-ene-4,8-diol |
|---|---|
| PubChem CID | 146166589 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | (3S,4S,5R,8S,9S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadec-6-ene-4,8-diol |
| SMILES | CCN1CC2(COC)CCC(OC)C34C5C[C@@H]6C=C[C@](O)([C@@H](C[C@H]23)C14)[C@@H]5[C@H]6O |
| InChI | InChI=1S/C23H35NO4/c1-4-24-11-21(12-27-2)7-6-17(28-3)23-14-9-13-5-8-22(26,18(14)19(13)25)15(20(23)24)10-16(21)23/h5,8,13-20,25-26H,4,6-7,9-12H2,1-3H3/t13-,14?,15-,16+,17?,18-,19-,20?,21?,22-,23?/m0/s1 |
| InChIKey | QYUGOUBBYKWQFZ-OPZQOPKHSA-N |
| XLogP | 1.68 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|