C23H37NO7 — CID 177423101
(1R,2S,3S,4S,5R,6S,8S,9S,10S,13S,16S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,6,8,9-pentol (PubChem CID 177423101) has the molecular formula C23H37NO7 and a molecular weight of 439.55 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R,6S,8S,9S,10S,13S,16S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,6,8,9-pentol.
| Compound Name | (1R,2S,3S,4S,5R,6S,8S,9S,10S,13S,16S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,6,8,9-pentol |
|---|---|
| PubChem CID | 177423101 |
| Molecular Formula | C23H37NO7 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (1R,2S,3S,4S,5R,6S,8S,9S,10S,13S,16S,17R)-11-ethyl-16-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,6,8,9-pentol |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34[C@@H]2C[C@](O)([C@@H]13)[C@@]1(O)C[C@H](O)[C@H]2C[C@@H]4[C@]1(O)[C@H]2O |
| InChI | InChI=1S/C23H37NO7/c1-4-24-10-19(11-30-2)6-5-16(31-3)22-14-7-12-13(25)8-21(28,23(14,29)17(12)26)20(27,18(22)24)9-15(19)22/h12-18,25-29H,4-11H2,1-3H3/t12-,13+,14+,15-,16+,17+,18-,19+,20+,21+,22-,23+/m1/s1 |
| InChIKey | SXROXQDCXSEROZ-OWZCFRHFSA-N |
| XLogP | -0.89 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |