C24H39NO5 — CID 176643654
(1S,4S,5S,6S,8S,10R,13S,16S)-11-ethyl-13-(hydroxymethyl)-6,8,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-ol (PubChem CID 176643654) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is (1S,4S,5S,6S,8S,10R,13S,16S)-11-ethyl-13-(hydroxymethyl)-6,8,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-ol.
| Compound Name | (1S,4S,5S,6S,8S,10R,13S,16S)-11-ethyl-13-(hydroxymethyl)-6,8,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-ol |
|---|---|
| PubChem CID | 176643654 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (1S,4S,5S,6S,8S,10R,13S,16S)-11-ethyl-13-(hydroxymethyl)-6,8,16-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-ol |
| SMILES | CCN1C[C@]2(CO)CC[C@H](OC)[C@@]34C5C[C@H]6C(O)C5[C@](OC)(C[C@@H]6OC)C(CC23)[C@@H]14 |
| InChI | InChI=1S/C24H39NO5/c1-5-25-11-22(12-26)7-6-18(29-3)24-14-8-13-16(28-2)10-23(30-4,19(14)20(13)27)15(21(24)25)9-17(22)24/h13-21,26-27H,5-12H2,1-4H3/t13-,14?,15?,16+,17?,18+,19?,20?,21-,22+,23+,24-/m1/s1 |
| InChIKey | PNDCQVOXNINPLA-ZWNQKIRDSA-N |
| XLogP | 1.53 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |