C22H32O13 — CID 162895719
[3,4,5-trihydroxy-6-(2,3,4,5-tetrahydroxyhexoxy)oxan-2-yl]methyl 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 162895719) has the molecular formula C22H32O13 and a molecular weight of 504.49 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(2,3,4,5-tetrahydroxyhexoxy)oxan-2-yl]methyl 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [3,4,5-trihydroxy-6-(2,3,4,5-tetrahydroxyhexoxy)oxan-2-yl]methyl 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162895719 |
| Molecular Formula | C22H32O13 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | [3,4,5-trihydroxy-6-(2,3,4,5-tetrahydroxyhexoxy)oxan-2-yl]methyl 3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OCC2OC(OCC(O)C(O)C(O)C(C)O)C(O)C(O)C2O)cc1O |
| InChI | InChI=1S/C22H32O13/c1-10(23)17(27)18(28)13(25)8-34-22-21(31)20(30)19(29)15(35-22)9-33-16(26)6-4-11-3-5-14(32-2)12(24)7-11/h3-7,10,13,15,17-25,27-31H,8-9H2,1-2H3 |
| InChIKey | WRGLSFQHWCYXLS-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 215.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|