C20H26O12 — CID 11259654
[2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-acetyloxy-3-hydroxyphenyl)prop-2-enoate (PubChem CID 11259654) has the molecular formula C20H26O12 and a molecular weight of 458.42 g/mol. Its IUPAC name is [2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-acetyloxy-3-hydroxyphenyl)prop-2-enoate.
| Compound Name | [2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-acetyloxy-3-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11259654 |
| Molecular Formula | C20H26O12 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-acetyloxy-3-hydroxyphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)OCC(O)CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C20H26O12/c1-10(22)31-14-4-2-11(6-13(14)24)3-5-16(25)29-8-12(23)9-30-20-19(28)18(27)17(26)15(7-21)32-20/h2-6,12,15,17-21,23-24,26-28H,7-9H2,1H3/b5-3+/t12?,15-,17-,18+,19-,20-/m1/s1 |
| InChIKey | UWIXNZGLUYYNRV-QGFAGMBISA-N |
| XLogP | -1.95 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|